C11H19NO3S — CID 110848852
(1,1-dioxothian-4-yl)-piperidin-1-ylmethanone (PubChem CID 110848852) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is (1,1-dioxothian-4-yl)-piperidin-1-ylmethanone.
| Compound Name | (1,1-dioxothian-4-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 110848852 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (1,1-dioxothian-4-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(C1CCS(=O)(=O)CC1)N1CCCCC1 |
| InChI | InChI=1S/C11H19NO3S/c13-11(12-6-2-1-3-7-12)10-4-8-16(14,15)9-5-10/h10H,1-9H2 |
| InChIKey | HEPGYVCXYAWHIZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |