C11H18N2O4S — CID 110850182
4-(1,1-dioxothiane-4-carbonyl)piperazine-1-carbaldehyde (PubChem CID 110850182) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 4-(1,1-dioxothiane-4-carbonyl)piperazine-1-carbaldehyde.
| Compound Name | 4-(1,1-dioxothiane-4-carbonyl)piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 110850182 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-(1,1-dioxothiane-4-carbonyl)piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(C(=O)C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C11H18N2O4S/c14-9-12-3-5-13(6-4-12)11(15)10-1-7-18(16,17)8-2-10/h9-10H,1-8H2 |
| InChIKey | FBTRHSVAMMVQDT-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|