C12H20ClNO3S — CID 113272694
N-[(2-chlorocyclohexyl)methyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 113272694) has the molecular formula C12H20ClNO3S and a molecular weight of 293.82 g/mol. Its IUPAC name is N-[(2-chlorocyclohexyl)methyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-[(2-chlorocyclohexyl)methyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 113272694 |
| Molecular Formula | C12H20ClNO3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-[(2-chlorocyclohexyl)methyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(NCC1CCCCC1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20ClNO3S/c13-11-4-2-1-3-9(11)7-14-12(15)10-5-6-18(16,17)8-10/h9-11H,1-8H2,(H,14,15) |
| InChIKey | VHYIMJLZGXMAQR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|