C14H23NO3S — CID 126818457
N-(1,1-dicyclopropylpropyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 126818457) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is N-(1,1-dicyclopropylpropyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(1,1-dicyclopropylpropyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 126818457 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-(1,1-dicyclopropylpropyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | CCC(NC(=O)C1CCS(=O)(=O)C1)(C1CC1)C1CC1 |
| InChI | InChI=1S/C14H23NO3S/c1-2-14(11-3-4-11,12-5-6-12)15-13(16)10-7-8-19(17,18)9-10/h10-12H,2-9H2,1H3,(H,15,16) |
| InChIKey | XDSMEKKNIBDSOI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |