C19H21NO3S — CID 95149760
(3R)-N-(1,1-diphenylethyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 95149760) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is (3R)-N-(1,1-diphenylethyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3R)-N-(1,1-diphenylethyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 95149760 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (3R)-N-(1,1-diphenylethyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | CC(NC(=O)[C@H]1CCS(=O)(=O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO3S/c1-19(16-8-4-2-5-9-16,17-10-6-3-7-11-17)20-18(21)15-12-13-24(22,23)14-15/h2-11,15H,12-14H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | ZUOCPIIIBNIPNI-HNNXBMFYSA-N |
| XLogP | 2.50 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |