C11H19N2O3- — CID 6956443
(2S,3R)-3-methyl-2-(pyrrolidine-1-carbonylamino)pentanoate (PubChem CID 6956443) has the molecular formula C11H19N2O3- and a molecular weight of 227.28 g/mol. Its IUPAC name is (2S,3R)-3-methyl-2-(pyrrolidine-1-carbonylamino)pentanoate.
| Compound Name | (2S,3R)-3-methyl-2-(pyrrolidine-1-carbonylamino)pentanoate |
|---|---|
| PubChem CID | 6956443 |
| Molecular Formula | C11H19N2O3- |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | (2S,3R)-3-methyl-2-(pyrrolidine-1-carbonylamino)pentanoate |
| SMILES | CC[C@@H](C)[C@H](NC(=O)N1CCCC1)C(=O)[O-] |
| InChI | InChI=1S/C11H20N2O3/c1-3-8(2)9(10(14)15)12-11(16)13-6-4-5-7-13/h8-9H,3-7H2,1-2H3,(H,12,16)(H,14,15)/p-1/t8-,9+/m1/s1 |
| InChIKey | KTOQGKOUGRAJPY-BDAKNGLRSA-M |
| XLogP | -0.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |