C10H19NO5 — CID 103021727
methyl 3-hydroxy-2-[(3-methoxy-3-methylbutanoyl)amino]propanoate (PubChem CID 103021727) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[(3-methoxy-3-methylbutanoyl)amino]propanoate.
| Compound Name | methyl 3-hydroxy-2-[(3-methoxy-3-methylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 103021727 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | methyl 3-hydroxy-2-[(3-methoxy-3-methylbutanoyl)amino]propanoate |
| SMILES | COC(=O)C(CO)NC(=O)CC(C)(C)OC |
| InChI | InChI=1S/C10H19NO5/c1-10(2,16-4)5-8(13)11-7(6-12)9(14)15-3/h7,12H,5-6H2,1-4H3,(H,11,13) |
| InChIKey | OSNNZBMENIVNJX-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |