C10H19NO5 — CID 107823761
(2R)-4-hydroxy-2-[(3-methoxy-3-methylbutanoyl)amino]butanoic acid (PubChem CID 107823761) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-[(3-methoxy-3-methylbutanoyl)amino]butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-[(3-methoxy-3-methylbutanoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107823761 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (2R)-4-hydroxy-2-[(3-methoxy-3-methylbutanoyl)amino]butanoic acid |
| SMILES | COC(C)(C)CC(=O)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C10H19NO5/c1-10(2,16-3)6-8(13)11-7(4-5-12)9(14)15/h7,12H,4-6H2,1-3H3,(H,11,13)(H,14,15)/t7-/m1/s1 |
| InChIKey | QVKMHWBWCZNLMV-SSDOTTSWSA-N |
| XLogP | -0.25 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |