C10H15NO9 — CID 140946110
2-[2-[(1-carboxy-3-hydroxypropyl)amino]-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 140946110) has the molecular formula C10H15NO9 and a molecular weight of 293.23 g/mol. Its IUPAC name is 2-[2-[(1-carboxy-3-hydroxypropyl)amino]-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-[(1-carboxy-3-hydroxypropyl)amino]-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 140946110 |
| Molecular Formula | C10H15NO9 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[2-[(1-carboxy-3-hydroxypropyl)amino]-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)NC(CCO)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H15NO9/c12-2-1-5(8(16)17)11-6(13)3-10(20,9(18)19)4-7(14)15/h5,12,20H,1-4H2,(H,11,13)(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | XJKOAELJRPOZSC-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |