C10H21NO3 — CID 103021223
N-[(2S)-1-hydroxybutan-2-yl]-3-methoxy-3-methylbutanamide (PubChem CID 103021223) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is N-[(2S)-1-hydroxybutan-2-yl]-3-methoxy-3-methylbutanamide.
| Compound Name | N-[(2S)-1-hydroxybutan-2-yl]-3-methoxy-3-methylbutanamide |
|---|---|
| PubChem CID | 103021223 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | N-[(2S)-1-hydroxybutan-2-yl]-3-methoxy-3-methylbutanamide |
| SMILES | CC[C@@H](CO)NC(=O)CC(C)(C)OC |
| InChI | InChI=1S/C10H21NO3/c1-5-8(7-12)11-9(13)6-10(2,3)14-4/h8,12H,5-7H2,1-4H3,(H,11,13)/t8-/m0/s1 |
| InChIKey | CYFKSYYSYPGURB-QMMMGPOBSA-N |
| XLogP | 0.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |