C12H12F2INO3 — CID 103493208
methyl 3-[[2-(3,4-difluorophenyl)acetyl]amino]-2-iodopropanoate (PubChem CID 103493208) has the molecular formula C12H12F2INO3 and a molecular weight of 383.13 g/mol. Its IUPAC name is methyl 3-[[2-(3,4-difluorophenyl)acetyl]amino]-2-iodopropanoate.
| Compound Name | methyl 3-[[2-(3,4-difluorophenyl)acetyl]amino]-2-iodopropanoate |
|---|---|
| PubChem CID | 103493208 |
| Molecular Formula | C12H12F2INO3 |
| Molecular Weight | 383.13 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | methyl 3-[[2-(3,4-difluorophenyl)acetyl]amino]-2-iodopropanoate |
| SMILES | COC(=O)C(I)CNC(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H12F2INO3/c1-19-12(18)10(15)6-16-11(17)5-7-2-3-8(13)9(14)4-7/h2-4,10H,5-6H2,1H3,(H,16,17) |
| InChIKey | DFTSGYUTRDRZCB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.13 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|