C13H18F2N2O — CID 120652869
2-(3,4-difluorophenyl)-N-[(2R)-2-(ethylamino)propyl]acetamide (PubChem CID 120652869) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-[(2R)-2-(ethylamino)propyl]acetamide.
| Compound Name | 2-(3,4-difluorophenyl)-N-[(2R)-2-(ethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 120652869 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-[(2R)-2-(ethylamino)propyl]acetamide |
| SMILES | CCN[C@H](C)CNC(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H18F2N2O/c1-3-16-9(2)8-17-13(18)7-10-4-5-11(14)12(15)6-10/h4-6,9,16H,3,7-8H2,1-2H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | ZHQLILSASRBFLK-SECBINFHSA-N |
| XLogP | 1.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |