C13H18ClFN2O2 — CID 120653969
2-(3-chloro-4-fluorophenoxy)-N-[(2R)-2-(ethylamino)propyl]acetamide (PubChem CID 120653969) has the molecular formula C13H18ClFN2O2 and a molecular weight of 288.75 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenoxy)-N-[(2R)-2-(ethylamino)propyl]acetamide.
| Compound Name | 2-(3-chloro-4-fluorophenoxy)-N-[(2R)-2-(ethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 120653969 |
| Molecular Formula | C13H18ClFN2O2 |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-(3-chloro-4-fluorophenoxy)-N-[(2R)-2-(ethylamino)propyl]acetamide |
| SMILES | CCN[C@H](C)CNC(=O)COc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClFN2O2/c1-3-16-9(2)7-17-13(18)8-19-10-4-5-12(15)11(14)6-10/h4-6,9,16H,3,7-8H2,1-2H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | PBUFMLWVADJPQJ-SECBINFHSA-N |
| XLogP | 1.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |