C20H27ClN2O3 — CID 120654572
N-[(2R)-2-(ethylamino)propyl]-2-(4-phenylmethoxyphenoxy)acetamide;hydrochloride (PubChem CID 120654572) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2-(4-phenylmethoxyphenoxy)acetamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2-(4-phenylmethoxyphenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120654572 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2-(4-phenylmethoxyphenoxy)acetamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)COc1ccc(OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H26N2O3.ClH/c1-3-21-16(2)13-22-20(23)15-25-19-11-9-18(10-12-19)24-14-17-7-5-4-6-8-17;/h4-12,16,21H,3,13-15H2,1-2H3,(H,22,23);1H/t16-;/m1./s1 |
| InChIKey | AUJBGBWHFHHPGT-PKLMIRHRSA-N |
| XLogP | 3.18 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |