C14H21ClO3 — CID 55151581
4-(2-chloro-4-ethoxybutyl)-1,2-dimethoxybenzene (PubChem CID 55151581) has the molecular formula C14H21ClO3 and a molecular weight of 272.77 g/mol. Its IUPAC name is 4-(2-chloro-4-ethoxybutyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(2-chloro-4-ethoxybutyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 55151581 |
| Molecular Formula | C14H21ClO3 |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 4-(2-chloro-4-ethoxybutyl)-1,2-dimethoxybenzene |
| SMILES | CCOCCC(Cl)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H21ClO3/c1-4-18-8-7-12(15)9-11-5-6-13(16-2)14(10-11)17-3/h5-6,10,12H,4,7-9H2,1-3H3 |
| InChIKey | DFHQMGVHVSBFNY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|