C15H21ClO4 — CID 82352083
methyl 3-chloro-4-(3,4-diethoxyphenyl)butanoate (PubChem CID 82352083) has the molecular formula C15H21ClO4 and a molecular weight of 300.78 g/mol. Its IUPAC name is methyl 3-chloro-4-(3,4-diethoxyphenyl)butanoate.
| Compound Name | methyl 3-chloro-4-(3,4-diethoxyphenyl)butanoate |
|---|---|
| PubChem CID | 82352083 |
| Molecular Formula | C15H21ClO4 |
| Molecular Weight | 300.78 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | methyl 3-chloro-4-(3,4-diethoxyphenyl)butanoate |
| SMILES | CCOc1ccc(CC(Cl)CC(=O)OC)cc1OCC |
| InChI | InChI=1S/C15H21ClO4/c1-4-19-13-7-6-11(9-14(13)20-5-2)8-12(16)10-15(17)18-3/h6-7,9,12H,4-5,8,10H2,1-3H3 |
| InChIKey | XJCCOWAOZBAGQL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.78 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|