C16H23ClO3 — CID 82184943
2-chloro-1-(3-ethoxy-4-methoxyphenyl)-4,4-dimethylpentan-3-one (PubChem CID 82184943) has the molecular formula C16H23ClO3 and a molecular weight of 298.81 g/mol. Its IUPAC name is 2-chloro-1-(3-ethoxy-4-methoxyphenyl)-4,4-dimethylpentan-3-one.
| Compound Name | 2-chloro-1-(3-ethoxy-4-methoxyphenyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 82184943 |
| Molecular Formula | C16H23ClO3 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-chloro-1-(3-ethoxy-4-methoxyphenyl)-4,4-dimethylpentan-3-one |
| SMILES | CCOc1cc(CC(Cl)C(=O)C(C)(C)C)ccc1OC |
| InChI | InChI=1S/C16H23ClO3/c1-6-20-14-10-11(7-8-13(14)19-5)9-12(17)15(18)16(2,3)4/h7-8,10,12H,6,9H2,1-5H3 |
| InChIKey | RBVCPRZXRPLKTK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|