C10H15NO2 — CID 71777141
N,N,1,1,2,2-hexadeuterio-2-(2,5-dimethoxyphenyl)ethanamine (PubChem CID 71777141) has the molecular formula C10H15NO2 and a molecular weight of 187.27 g/mol. Its IUPAC name is N,N,1,1,2,2-hexadeuterio-2-(2,5-dimethoxyphenyl)ethanamine.
| Compound Name | N,N,1,1,2,2-hexadeuterio-2-(2,5-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 71777141 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | N,N,1,1,2,2-hexadeuterio-2-(2,5-dimethoxyphenyl)ethanamine |
| SMILES | [2H]N([2H])C([2H])([2H])C([2H])([2H])c1cc(OC)ccc1OC |
| InChI | InChI=1S/C10H15NO2/c1-12-9-3-4-10(13-2)8(7-9)5-6-11/h3-4,7H,5-6,11H2,1-2H3/i5D2,6D2/hD2 |
| InChIKey | WNCUVUUEJZEATP-JGYJCWKTSA-N |
| XLogP | 1.21 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |