C13H20O4 — CID 62019338
[3-(2-ethoxyethoxymethyl)-4-methoxyphenyl]methanol (PubChem CID 62019338) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is [3-(2-ethoxyethoxymethyl)-4-methoxyphenyl]methanol.
| Compound Name | [3-(2-ethoxyethoxymethyl)-4-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 62019338 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [3-(2-ethoxyethoxymethyl)-4-methoxyphenyl]methanol |
| SMILES | CCOCCOCc1cc(CO)ccc1OC |
| InChI | InChI=1S/C13H20O4/c1-3-16-6-7-17-10-12-8-11(9-14)4-5-13(12)15-2/h4-5,8,14H,3,6-7,9-10H2,1-2H3 |
| InChIKey | NQFRWTSCYUGLQO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|