C15H22O3 — CID 106204024
[3-(2-cyclobutylethoxymethyl)-4-methoxyphenyl]methanol (PubChem CID 106204024) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is [3-(2-cyclobutylethoxymethyl)-4-methoxyphenyl]methanol.
| Compound Name | [3-(2-cyclobutylethoxymethyl)-4-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 106204024 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | [3-(2-cyclobutylethoxymethyl)-4-methoxyphenyl]methanol |
| SMILES | COc1ccc(CO)cc1COCCC1CCC1 |
| InChI | InChI=1S/C15H22O3/c1-17-15-6-5-13(10-16)9-14(15)11-18-8-7-12-3-2-4-12/h5-6,9,12,16H,2-4,7-8,10-11H2,1H3 |
| InChIKey | WJFORMAMBFRLMM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|