C14H21NO2 — CID 106200104
4-(2-cyclobutylethoxymethyl)-3-methoxyaniline (PubChem CID 106200104) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-(2-cyclobutylethoxymethyl)-3-methoxyaniline.
| Compound Name | 4-(2-cyclobutylethoxymethyl)-3-methoxyaniline |
|---|---|
| PubChem CID | 106200104 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 4-(2-cyclobutylethoxymethyl)-3-methoxyaniline |
| SMILES | COc1cc(N)ccc1COCCC1CCC1 |
| InChI | InChI=1S/C14H21NO2/c1-16-14-9-13(15)6-5-12(14)10-17-8-7-11-3-2-4-11/h5-6,9,11H,2-4,7-8,10,15H2,1H3 |
| InChIKey | OISISNZIWBIWPH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|