C20H25NO5 — CID 146217527
3-[3-amino-4-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]phenyl]propanoic acid (PubChem CID 146217527) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is 3-[3-amino-4-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 146217527 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-[3-amino-4-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]phenyl]propanoic acid |
| SMILES | CCOCc1cc(OC)c(-c2ccc(CCC(=O)O)cc2N)c(OC)c1 |
| InChI | InChI=1S/C20H25NO5/c1-4-26-12-14-10-17(24-2)20(18(11-14)25-3)15-7-5-13(9-16(15)21)6-8-19(22)23/h5,7,9-11H,4,6,8,12,21H2,1-3H3,(H,22,23) |
| InChIKey | JVOBATKZPRQYRV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|