C14H18N2O2 — CID 117368202
2,3-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzonitrile (PubChem CID 117368202) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzonitrile.
| Compound Name | 2,3-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzonitrile |
|---|---|
| PubChem CID | 117368202 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2,3-dimethoxy-5-(pyrrolidin-2-ylmethyl)benzonitrile |
| SMILES | COc1cc(CC2CCCN2)cc(C#N)c1OC |
| InChI | InChI=1S/C14H18N2O2/c1-17-13-8-10(7-12-4-3-5-16-12)6-11(9-15)14(13)18-2/h6,8,12,16H,3-5,7H2,1-2H3 |
| InChIKey | LEUKMKZVBJODHC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |