C10H12N2O2 — CID 117282956
5-(aminomethyl)-2,3-dimethoxybenzonitrile (PubChem CID 117282956) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 5-(aminomethyl)-2,3-dimethoxybenzonitrile.
| Compound Name | 5-(aminomethyl)-2,3-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 117282956 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 5-(aminomethyl)-2,3-dimethoxybenzonitrile |
| SMILES | COc1cc(CN)cc(C#N)c1OC |
| InChI | InChI=1S/C10H12N2O2/c1-13-9-4-7(5-11)3-8(6-12)10(9)14-2/h3-4H,5,11H2,1-2H3 |
| InChIKey | XWALOOYGZDPJHX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |