C13H12O — CID 5319414
1-hexa-2,4-diynyl-2-methoxybenzene (PubChem CID 5319414) has the molecular formula C13H12O and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-hexa-2,4-diynyl-2-methoxybenzene.
| Compound Name | 1-hexa-2,4-diynyl-2-methoxybenzene |
|---|---|
| PubChem CID | 5319414 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 1-hexa-2,4-diynyl-2-methoxybenzene |
| SMILES | CC#CC#CCc1ccccc1OC |
| InChI | InChI=1S/C13H12O/c1-3-4-5-6-9-12-10-7-8-11-13(12)14-2/h7-8,10-11H,9H2,1-2H3 |
| InChIKey | AWBXMNYCXOZEMM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|