C18H11NO — CID 59977954
3-dodeca-2,4,6,8,10-pentaynyl-2-methoxypyridine (PubChem CID 59977954) has the molecular formula C18H11NO and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-dodeca-2,4,6,8,10-pentaynyl-2-methoxypyridine.
| Compound Name | 3-dodeca-2,4,6,8,10-pentaynyl-2-methoxypyridine |
|---|---|
| PubChem CID | 59977954 |
| Molecular Formula | C18H11NO |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-dodeca-2,4,6,8,10-pentaynyl-2-methoxypyridine |
| SMILES | CC#CC#CC#CC#CC#CCc1cccnc1OC |
| InChI | InChI=1S/C18H11NO/c1-3-4-5-6-7-8-9-10-11-12-14-17-15-13-16-19-18(17)20-2/h13,15-16H,14H2,1-2H3 |
| InChIKey | GSZMSSMFSMEQEW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|