C12H14N2O2 — CID 67925876
2-[3-(2-methoxyphenyl)prop-1-ynylamino]acetamide (PubChem CID 67925876) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[3-(2-methoxyphenyl)prop-1-ynylamino]acetamide.
| Compound Name | 2-[3-(2-methoxyphenyl)prop-1-ynylamino]acetamide |
|---|---|
| PubChem CID | 67925876 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-[3-(2-methoxyphenyl)prop-1-ynylamino]acetamide |
| SMILES | COc1ccccc1CC#CNCC(N)=O |
| InChI | InChI=1S/C12H14N2O2/c1-16-11-7-3-2-5-10(11)6-4-8-14-9-12(13)15/h2-3,5,7,14H,6,9H2,1H3,(H2,13,15) |
| InChIKey | ZKNRGEFCEKKMGX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|