About (2-methoxyphenyl)methyl selenocyanate
(2-methoxyphenyl)methyl selenocyanate (PubChem CID 10331260) has the molecular formula C9H9NOSe
and a molecular weight of 226.14 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl selenocyanate.
Molecular Properties
| Compound Name | (2-methoxyphenyl)methyl selenocyanate |
| PubChem CID | 10331260 |
| Molecular Formula | C9H9NOSe |
| Molecular Weight | 226.14 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | (2-methoxyphenyl)methyl selenocyanate |
| SMILES | COc1ccccc1C[Se]C#N |
| InChI | InChI=1S/C9H9NOSe/c1-11-9-5-3-2-4-8(9)6-12-7-10/h2-5H,6H2,1H3 |
| InChIKey | ISKGOWGFBASPHO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.14 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxyphenyl)methyl selenocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxyphenyl)methyl selenocyanate?
The IUPAC name of (2-methoxyphenyl)methyl selenocyanate (CID 10331260) is (2-methoxyphenyl)methyl selenocyanate.
What is the SMILES notation for (2-methoxyphenyl)methyl selenocyanate?
The canonical SMILES for (2-methoxyphenyl)methyl selenocyanate is COc1ccccc1C[Se]C#N.
What is the InChIKey of (2-methoxyphenyl)methyl selenocyanate?
The InChIKey is ISKGOWGFBASPHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NOSe/c1-11-9-5-3-2-4-8(9)6-12-7-10/h2-5H,6H2,1H3.
What are the key properties of (2-methoxyphenyl)methyl selenocyanate?
(2-methoxyphenyl)methyl selenocyanate has a molecular weight of 226.14 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyphenyl)methyl selenocyanate is sourced from PubChem (CID 10331260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).