C14H13NO2Se — CID 51040592
(1,4-dimethoxynaphthalen-2-yl)methyl selenocyanate (PubChem CID 51040592) has the molecular formula C14H13NO2Se and a molecular weight of 306.22 g/mol. Its IUPAC name is (1,4-dimethoxynaphthalen-2-yl)methyl selenocyanate.
| Compound Name | (1,4-dimethoxynaphthalen-2-yl)methyl selenocyanate |
|---|---|
| PubChem CID | 51040592 |
| Molecular Formula | C14H13NO2Se |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | (1,4-dimethoxynaphthalen-2-yl)methyl selenocyanate |
| SMILES | COc1cc(C[Se]C#N)c(OC)c2ccccc12 |
| InChI | InChI=1S/C14H13NO2Se/c1-16-13-7-10(8-18-9-15)14(17-2)12-6-4-3-5-11(12)13/h3-7H,8H2,1-2H3 |
| InChIKey | YTFOSAMEMRJHRM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|