C17H22O6S — CID 101000982
2-(2,2-dimethoxyethylsulfonylmethyl)-1,4-dimethoxynaphthalene (PubChem CID 101000982) has the molecular formula C17H22O6S and a molecular weight of 354.42 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylsulfonylmethyl)-1,4-dimethoxynaphthalene.
| Compound Name | 2-(2,2-dimethoxyethylsulfonylmethyl)-1,4-dimethoxynaphthalene |
|---|---|
| PubChem CID | 101000982 |
| Molecular Formula | C17H22O6S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-(2,2-dimethoxyethylsulfonylmethyl)-1,4-dimethoxynaphthalene |
| SMILES | COc1cc(CS(=O)(=O)CC(OC)OC)c(OC)c2ccccc12 |
| InChI | InChI=1S/C17H22O6S/c1-20-15-9-12(10-24(18,19)11-16(21-2)22-3)17(23-4)14-8-6-5-7-13(14)15/h5-9,16H,10-11H2,1-4H3 |
| InChIKey | LDPZDTNGGGKVMV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|