C13H14O3S — CID 139590661
1,4-dimethoxy-2-methylsulfinylnaphthalene (PubChem CID 139590661) has the molecular formula C13H14O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is 1,4-dimethoxy-2-methylsulfinylnaphthalene.
| Compound Name | 1,4-dimethoxy-2-methylsulfinylnaphthalene |
|---|---|
| PubChem CID | 139590661 |
| Molecular Formula | C13H14O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 1,4-dimethoxy-2-methylsulfinylnaphthalene |
| SMILES | COc1cc(S(C)=O)c(OC)c2ccccc12 |
| InChI | InChI=1S/C13H14O3S/c1-15-11-8-12(17(3)14)13(16-2)10-7-5-4-6-9(10)11/h4-8H,1-3H3 |
| InChIKey | XSMOSYUKLPYTRX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |