C16H18NO3W- — CID 59623856
3-(1,4-dimethoxynaphthalen-2-yl)-2-(methylamino)propan-1-one;tungsten (PubChem CID 59623856) has the molecular formula C16H18NO3W- and a molecular weight of 456.16 g/mol. Its IUPAC name is 3-(1,4-dimethoxynaphthalen-2-yl)-2-(methylamino)propan-1-one;tungsten.
| Compound Name | 3-(1,4-dimethoxynaphthalen-2-yl)-2-(methylamino)propan-1-one;tungsten |
|---|---|
| PubChem CID | 59623856 |
| Molecular Formula | C16H18NO3W- |
| Molecular Weight | 456.16 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 3-(1,4-dimethoxynaphthalen-2-yl)-2-(methylamino)propan-1-one;tungsten |
| SMILES | CNC([C-]=O)Cc1cc(OC)c2ccccc2c1OC.[W] |
| InChI | InChI=1S/C16H18NO3.W/c1-17-12(10-18)8-11-9-15(19-2)13-6-4-5-7-14(13)16(11)20-3;/h4-7,9,12,17H,8H2,1-3H3;/q-1; |
| InChIKey | IHPOLTNIZFBEAP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|