C22H19ClN2O2 — CID 50994489
2-[(4-chlorophenyl)methylideneamino]-3-(1,4-dimethoxynaphthalen-2-yl)propanenitrile (PubChem CID 50994489) has the molecular formula C22H19ClN2O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylideneamino]-3-(1,4-dimethoxynaphthalen-2-yl)propanenitrile.
| Compound Name | 2-[(4-chlorophenyl)methylideneamino]-3-(1,4-dimethoxynaphthalen-2-yl)propanenitrile |
|---|---|
| PubChem CID | 50994489 |
| Molecular Formula | C22H19ClN2O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 2-[(4-chlorophenyl)methylideneamino]-3-(1,4-dimethoxynaphthalen-2-yl)propanenitrile |
| SMILES | COc1cc(CC(C#N)/N=C/c2ccc(Cl)cc2)c(OC)c2ccccc12 |
| InChI | InChI=1S/C22H19ClN2O2/c1-26-21-12-16(22(27-2)20-6-4-3-5-19(20)21)11-18(13-24)25-14-15-7-9-17(23)10-8-15/h3-10,12,14,18H,11H2,1-2H3/b25-14+ |
| InChIKey | NBXYOBLQGBITLE-AFUMVMLFSA-N |
| XLogP | 5.06 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|