About (4-ethylcyclohexyl) 3-amino-2-methylbenzoate
(4-ethylcyclohexyl) 3-amino-2-methylbenzoate (PubChem CID 64774862) has the molecular formula C16H23NO2
and a molecular weight of 261.36 g/mol. Its IUPAC name is (4-ethylcyclohexyl) 3-amino-2-methylbenzoate.
Molecular Properties
| Compound Name | (4-ethylcyclohexyl) 3-amino-2-methylbenzoate |
| PubChem CID | 64774862 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (4-ethylcyclohexyl) 3-amino-2-methylbenzoate |
| SMILES | CCC1CCC(OC(=O)c2cccc(N)c2C)CC1 |
| InChI | InChI=1S/C16H23NO2/c1-3-12-7-9-13(10-8-12)19-16(18)14-5-4-6-15(17)11(14)2/h4-6,12-13H,3,7-10,17H2,1-2H3 |
| InChIKey | SRDIPSDHWNKOMG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylcyclohexyl) 3-amino-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylcyclohexyl) 3-amino-2-methylbenzoate?
The IUPAC name of (4-ethylcyclohexyl) 3-amino-2-methylbenzoate (CID 64774862) is (4-ethylcyclohexyl) 3-amino-2-methylbenzoate.
What is the SMILES notation for (4-ethylcyclohexyl) 3-amino-2-methylbenzoate?
The canonical SMILES for (4-ethylcyclohexyl) 3-amino-2-methylbenzoate is CCC1CCC(OC(=O)c2cccc(N)c2C)CC1.
What is the InChIKey of (4-ethylcyclohexyl) 3-amino-2-methylbenzoate?
The InChIKey is SRDIPSDHWNKOMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-3-12-7-9-13(10-8-12)19-16(18)14-5-4-6-15(17)11(14)2/h4-6,12-13H,3,7-10,17H2,1-2H3.
What are the key properties of (4-ethylcyclohexyl) 3-amino-2-methylbenzoate?
(4-ethylcyclohexyl) 3-amino-2-methylbenzoate has a molecular weight of 261.36 g/mol, XLogP of 3.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylcyclohexyl) 3-amino-2-methylbenzoate is sourced from PubChem (CID 64774862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).