About (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate
(4-ethylcyclohexyl) 4-amino-3-fluorobenzoate (PubChem CID 64776901) has the molecular formula C15H20FNO2
and a molecular weight of 265.33 g/mol. Its IUPAC name is (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate.
Molecular Properties
| Compound Name | (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate |
| PubChem CID | 64776901 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate |
| SMILES | CCC1CCC(OC(=O)c2ccc(N)c(F)c2)CC1 |
| InChI | InChI=1S/C15H20FNO2/c1-2-10-3-6-12(7-4-10)19-15(18)11-5-8-14(17)13(16)9-11/h5,8-10,12H,2-4,6-7,17H2,1H3 |
| InChIKey | QJESQJFABZYOMN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate?
The IUPAC name of (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate (CID 64776901) is (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate.
What is the SMILES notation for (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate?
The canonical SMILES for (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate is CCC1CCC(OC(=O)c2ccc(N)c(F)c2)CC1.
What is the InChIKey of (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate?
The InChIKey is QJESQJFABZYOMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FNO2/c1-2-10-3-6-12(7-4-10)19-15(18)11-5-8-14(17)13(16)9-11/h5,8-10,12H,2-4,6-7,17H2,1H3.
What are the key properties of (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate?
(4-ethylcyclohexyl) 4-amino-3-fluorobenzoate has a molecular weight of 265.33 g/mol, XLogP of 3.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylcyclohexyl) 4-amino-3-fluorobenzoate is sourced from PubChem (CID 64776901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).