C19H20O10 — CID 143917045
methyl 3,4,5-trihydroxy-2-[(2S,4S,6S)-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxobenzo[7]annulene-8-carboxylate (PubChem CID 143917045) has the molecular formula C19H20O10 and a molecular weight of 408.36 g/mol. Its IUPAC name is methyl 3,4,5-trihydroxy-2-[(2S,4S,6S)-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxobenzo[7]annulene-8-carboxylate.
| Compound Name | methyl 3,4,5-trihydroxy-2-[(2S,4S,6S)-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxobenzo[7]annulene-8-carboxylate |
|---|---|
| PubChem CID | 143917045 |
| Molecular Formula | C19H20O10 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | methyl 3,4,5-trihydroxy-2-[(2S,4S,6S)-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxobenzo[7]annulene-8-carboxylate |
| SMILES | COC(=O)c1cc(=O)c(O)c2c(O)c(O)c(O[C@H]3C[C@@H](O)C[C@@H](CO)O3)cc2c1 |
| InChI | InChI=1S/C19H20O10/c1-27-19(26)9-2-8-4-13(29-14-6-10(21)5-11(7-20)28-14)17(24)18(25)15(8)16(23)12(22)3-9/h2-4,10-11,14,20-21,24-25H,5-7H2,1H3,(H,22,23)/t10-,11-,14-/m0/s1 |
| InChIKey | WRVLFULRKLHOGN-MJVIPROJSA-N |
| XLogP | 0.34 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|