C22H26O12 — CID 154044250
methyl 2-[3-[(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropoxy]-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate (PubChem CID 154044250) has the molecular formula C22H26O12 and a molecular weight of 482.44 g/mol. Its IUPAC name is methyl 2-[3-[(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropoxy]-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate.
| Compound Name | methyl 2-[3-[(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropoxy]-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate |
|---|---|
| PubChem CID | 154044250 |
| Molecular Formula | C22H26O12 |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | methyl 2-[3-[(2R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropoxy]-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate |
| SMILES | COC(=O)c1cc(O)c(=O)c2c(O)c(O)c(OCCCO[C@H]3C[C@@H](O)[C@H](O)[C@@H](CO)O3)cc2c1 |
| InChI | InChI=1S/C22H26O12/c1-31-22(30)11-5-10-7-14(20(28)21(29)17(10)19(27)12(24)6-11)32-3-2-4-33-16-8-13(25)18(26)15(9-23)34-16/h5-7,13,15-16,18,23,25-26,28-29H,2-4,8-9H2,1H3,(H,24,27)/t13-,15-,16-,18+/m1/s1 |
| InChIKey | PBFNDBLTUPRFMO-IIVZCXTMSA-N |
| XLogP | -0.28 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|