C23H28O8 — CID 91181002
[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-yl]methyl propanoate (PubChem CID 91181002) has the molecular formula C23H28O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-yl]methyl propanoate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 91181002 |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@H]1OC(Oc2ccccc2Cc2ccc(OC)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H28O8/c1-3-19(24)29-13-18-20(25)21(26)22(27)23(31-18)30-17-7-5-4-6-15(17)12-14-8-10-16(28-2)11-9-14/h4-11,18,20-23,25-27H,3,12-13H2,1-2H3/t18-,20-,21+,22-,23?/m1/s1 |
| InChIKey | IFRDRANCUWLUOO-HZKCKKNMSA-N |
| XLogP | 1.43 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |