C21H26O7 — CID 68989703
(2R,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]phenoxy]-3-methyloxane-3,4,5-triol (PubChem CID 68989703) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]phenoxy]-3-methyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]phenoxy]-3-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 68989703 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methyl]phenoxy]-3-methyloxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2ccccc2O[C@H]2O[C@H](CO)[C@@](C)(O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C21H26O7/c1-21(25)17(12-22)28-20(18(23)19(21)24)27-16-6-4-3-5-14(16)11-13-7-9-15(26-2)10-8-13/h3-10,17-20,22-25H,11-12H2,1-2H3/t17-,18-,19-,20+,21-/m1/s1 |
| InChIKey | AOWHABGASLUDLS-SSSFQFABSA-N |
| XLogP | 0.85 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |