C23H29ClO4 — CID 143928541
[2-chloro-5-[3-hydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]-(4-propylphenyl)methanediol (PubChem CID 143928541) has the molecular formula C23H29ClO4 and a molecular weight of 404.93 g/mol. Its IUPAC name is [2-chloro-5-[3-hydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]-(4-propylphenyl)methanediol.
| Compound Name | [2-chloro-5-[3-hydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]-(4-propylphenyl)methanediol |
|---|---|
| PubChem CID | 143928541 |
| Molecular Formula | C23H29ClO4 |
| Molecular Weight | 404.93 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [2-chloro-5-[3-hydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]-(4-propylphenyl)methanediol |
| SMILES | CCCc1ccc(C(O)(O)c2cc(C3CC(O)CC(CO)C3)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H29ClO4/c1-2-3-15-4-7-19(8-5-15)23(27,28)21-13-17(6-9-22(21)24)18-10-16(14-25)11-20(26)12-18/h4-9,13,16,18,20,25-28H,2-3,10-12,14H2,1H3 |
| InChIKey | QWHQEUCGWREGEO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.93 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|