C24H30O5 — CID 46881762
(5R,7S,8R,9R,10S)-7-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-1,6-dioxaspiro[4.5]decane-8,9,10-triol (PubChem CID 46881762) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (5R,7S,8R,9R,10S)-7-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-1,6-dioxaspiro[4.5]decane-8,9,10-triol.
| Compound Name | (5R,7S,8R,9R,10S)-7-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-1,6-dioxaspiro[4.5]decane-8,9,10-triol |
|---|---|
| PubChem CID | 46881762 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (5R,7S,8R,9R,10S)-7-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-1,6-dioxaspiro[4.5]decane-8,9,10-triol |
| SMILES | CCc1ccc(Cc2cc([C@@H]3O[C@]4(CCCO4)[C@@H](O)[C@H](O)[C@H]3O)ccc2C)cc1 |
| InChI | InChI=1S/C24H30O5/c1-3-16-6-8-17(9-7-16)13-19-14-18(10-5-15(19)2)22-20(25)21(26)23(27)24(29-22)11-4-12-28-24/h5-10,14,20-23,25-27H,3-4,11-13H2,1-2H3/t20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | DDOXILQISMHBNE-URYYLNOGSA-N |
| XLogP | 2.81 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |