C23H27ClO4 — CID 67074452
(3S,4R,5R,6S)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]phenyl]-2,2-dimethyloxane-3,4,5-triol (PubChem CID 67074452) has the molecular formula C23H27ClO4 and a molecular weight of 402.92 g/mol. Its IUPAC name is (3S,4R,5R,6S)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]phenyl]-2,2-dimethyloxane-3,4,5-triol.
| Compound Name | (3S,4R,5R,6S)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]phenyl]-2,2-dimethyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 67074452 |
| Molecular Formula | C23H27ClO4 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (3S,4R,5R,6S)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]phenyl]-2,2-dimethyloxane-3,4,5-triol |
| SMILES | CC1(C)O[C@@H](c2ccc(Cl)c(Cc3ccc(C4CC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H27ClO4/c1-23(2)22(27)20(26)19(25)21(28-23)16-9-10-18(24)17(12-16)11-13-3-5-14(6-4-13)15-7-8-15/h3-6,9-10,12,15,19-22,25-27H,7-8,11H2,1-2H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | WQGRHBGBMIWRFK-CZYKHXBRSA-N |
| XLogP | 3.74 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |