C29H40ClNO8S — CID 75992763
N-[4-[4-[[2-chloro-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]butyl]cyclohexanesulfonamide (PubChem CID 75992763) has the molecular formula C29H40ClNO8S and a molecular weight of 598.16 g/mol. Its IUPAC name is N-[4-[4-[[2-chloro-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]butyl]cyclohexanesulfonamide.
| Compound Name | N-[4-[4-[[2-chloro-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]butyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 75992763 |
| Molecular Formula | C29H40ClNO8S |
| Molecular Weight | 598.16 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | N-[4-[4-[[2-chloro-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]butyl]cyclohexanesulfonamide |
| SMILES | O=S(=O)(NCCCCOc1ccc(Cc2cc(C3OC(CO)C(O)C(O)C3O)ccc2Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C29H40ClNO8S/c30-24-13-10-20(29-28(35)27(34)26(33)25(18-32)39-29)17-21(24)16-19-8-11-22(12-9-19)38-15-5-4-14-31-40(36,37)23-6-2-1-3-7-23/h8-13,17,23,25-29,31-35H,1-7,14-16,18H2 |
| InChIKey | GBLJAGQLSZOCBR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.16 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|