C21H26O7S — CID 58239076
(2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2,4-dihydroxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 58239076) has the molecular formula C21H26O7S and a molecular weight of 422.50 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2,4-dihydroxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2,4-dihydroxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 58239076 |
| Molecular Formula | C21H26O7S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2,4-dihydroxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3S[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)cc2O)cc1 |
| InChI | InChI=1S/C21H26O7S/c1-2-28-13-5-3-11(4-6-13)7-12-8-14(16(24)9-15(12)23)21-20(27)19(26)18(25)17(10-22)29-21/h3-6,8-9,17-27H,2,7,10H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | DWLXZXOIKYIGFE-ADAARDCZSA-N |
| XLogP | 1.32 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |