C23H30ClNO5S — CID 58239083
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 58239083) has the molecular formula C23H30ClNO5S and a molecular weight of 468.02 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 58239083 |
| Molecular Formula | C23H30ClNO5S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | CN(C)CCOc1ccc(Cc2cc([C@@H]3S[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H30ClNO5S/c1-25(2)9-10-30-17-6-3-14(4-7-17)11-16-12-15(5-8-18(16)24)23-22(29)21(28)20(27)19(13-26)31-23/h3-8,12,19-23,26-29H,9-11,13H2,1-2H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | GQXDGUIFTWPJJK-ZQGJOIPISA-N |
| XLogP | 2.10 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |