C22H25ClO5 — CID 134486726
(1S,2R,3R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 134486726) has the molecular formula C22H25ClO5 and a molecular weight of 404.89 g/mol. Its IUPAC name is (1S,2R,3R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2R,3R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 134486726 |
| Molecular Formula | C22H25ClO5 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (1S,2R,3R,6R)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | CCOc1ccc(Cc2cc([C@H]3C=C(CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H25ClO5/c1-2-28-17-6-3-13(4-7-17)9-15-10-14(5-8-19(15)23)18-11-16(12-24)20(25)22(27)21(18)26/h3-8,10-11,18,20-22,24-27H,2,9,12H2,1H3/t18-,20-,21+,22+/m1/s1 |
| InChIKey | FNOIFYXKFCWWOQ-YJMBLLCNSA-N |
| XLogP | 2.43 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|