C20H22ClNO6 — CID 173047425
2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-hydroxyiminooxane-3,4,5-triol (PubChem CID 173047425) has the molecular formula C20H22ClNO6 and a molecular weight of 407.85 g/mol. Its IUPAC name is 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-hydroxyiminooxane-3,4,5-triol.
| Compound Name | 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-hydroxyiminooxane-3,4,5-triol |
|---|---|
| PubChem CID | 173047425 |
| Molecular Formula | C20H22ClNO6 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-hydroxyiminooxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc(C3OC(=NO)C(O)C(O)C3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H22ClNO6/c1-2-27-14-6-3-11(4-7-14)9-13-10-12(5-8-15(13)21)19-17(24)16(23)18(25)20(22-26)28-19/h3-8,10,16-19,23-26H,2,9H2,1H3 |
| InChIKey | SRARBFGCMPBDLS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|