C25H25ClO6 — CID 91527050
(2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(furan-2-ylmethylidene)oxane-3,4,5-triol (PubChem CID 91527050) has the molecular formula C25H25ClO6 and a molecular weight of 456.92 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(furan-2-ylmethylidene)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(furan-2-ylmethylidene)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 91527050 |
| Molecular Formula | C25H25ClO6 |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | (2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(furan-2-ylmethylidene)oxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3OC(=Cc4ccco4)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H25ClO6/c1-2-30-18-8-5-15(6-9-18)12-17-13-16(7-10-20(17)26)25-24(29)23(28)22(27)21(32-25)14-19-4-3-11-31-19/h3-11,13-14,22-25,27-29H,2,12H2,1H3/t22-,23+,24-,25+/m1/s1 |
| InChIKey | GCPUXYXKTSEXMQ-RCTAOEEJSA-N |
| XLogP | 4.12 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |