C24H23ClO6 — CID 11711921
(2S,3R,4R,5S,6Z)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-(furan-2-ylmethylidene)oxane-3,4,5-triol (PubChem CID 11711921) has the molecular formula C24H23ClO6 and a molecular weight of 442.90 g/mol. Its IUPAC name is (2S,3R,4R,5S,6Z)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-(furan-2-ylmethylidene)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6Z)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-(furan-2-ylmethylidene)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11711921 |
| Molecular Formula | C24H23ClO6 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (2S,3R,4R,5S,6Z)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-(furan-2-ylmethylidene)oxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2cc([C@@H]3O/C(=C\c4ccco4)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H23ClO6/c1-29-17-7-4-14(5-8-17)11-16-12-15(6-9-19(16)25)24-23(28)22(27)21(26)20(31-24)13-18-3-2-10-30-18/h2-10,12-13,21-24,26-28H,11H2,1H3/b20-13-/t21-,22+,23-,24+/m1/s1 |
| InChIKey | ZTKGQZNFJZKDSX-PEDQSYHUSA-N |
| XLogP | 3.73 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |