C22H25FO6 — CID 58592566
(2S,3R,4R,5S,6Z)-2-[4-fluoro-3-[(4-methoxyphenyl)methyl]phenyl]-6-(2-methoxyethylidene)oxane-3,4,5-triol (PubChem CID 58592566) has the molecular formula C22H25FO6 and a molecular weight of 404.43 g/mol. Its IUPAC name is (2S,3R,4R,5S,6Z)-2-[4-fluoro-3-[(4-methoxyphenyl)methyl]phenyl]-6-(2-methoxyethylidene)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6Z)-2-[4-fluoro-3-[(4-methoxyphenyl)methyl]phenyl]-6-(2-methoxyethylidene)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58592566 |
| Molecular Formula | C22H25FO6 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (2S,3R,4R,5S,6Z)-2-[4-fluoro-3-[(4-methoxyphenyl)methyl]phenyl]-6-(2-methoxyethylidene)oxane-3,4,5-triol |
| SMILES | COC/C=C1\O[C@@H](c2ccc(F)c(Cc3ccc(OC)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H25FO6/c1-27-10-9-18-19(24)20(25)21(26)22(29-18)14-5-8-17(23)15(12-14)11-13-3-6-16(28-2)7-4-13/h3-9,12,19-22,24-26H,10-11H2,1-2H3/b18-9-/t19-,20+,21-,22+/m1/s1 |
| InChIKey | KIMFYRWJGWFOIG-VMNJLFIXSA-N |
| XLogP | 2.11 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |